40258-72-8 Usage
Uses
Used in Research Applications:
METHYL 3-BROMO-4-HYDROXY-5-NITROBENZENECARBOXYLATE is used as a research chemical in laboratories for various chemical reactions and organic synthesis processes. Its unique structure and functional groups make it a valuable compound for scientific investigations and experiments.
Used in Organic Synthesis:
In the field of organic chemistry, METHYL 3-BROMO-4-HYDROXY-5-NITROBENZENECARBOXYLATE is used as a reagent in the synthesis of various organic compounds. Its reactive nature and the presence of multiple functional groups allow it to participate in a wide range of chemical reactions, making it a versatile building block in the creation of new molecules and compounds.
Used in Academic Research:
METHYL 3-BROMO-4-HYDROXY-5-NITROBENZENECARBOXYLATE is also used in academic research settings, where it can be employed to study the effects of different functional groups on the properties and reactivity of organic compounds. This can help researchers gain a deeper understanding of the underlying principles of organic chemistry and contribute to the development of new synthetic methods and strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 40258-72-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,2,5 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 40258-72:
(7*4)+(6*0)+(5*2)+(4*5)+(3*8)+(2*7)+(1*2)=98
98 % 10 = 8
So 40258-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H6BrNO5/c1-15-8(12)4-2-5(9)7(11)6(3-4)10(13)14/h2-3,11H,1H3