4027-18-3 Usage
Uses
Used in Organic Synthesis:
4-oxo-4-[(tributylstannyl)oxy]but-2-enoic acid is used as a reagent in organic synthesis for the formation of carbon-carbon bonds. Its tributylstannyl group facilitates unique reactions that are valuable in constructing complex organic molecules, particularly in the synthesis of natural products and pharmaceuticals.
Used in Chemical Research:
In the field of chemical research, 4-oxo-4-[(tributylstannyl)oxy]but-2-enoic acid serves as a model compound for studying the reactivity and properties of organotin compounds. Its behavior in various reaction conditions can provide insights into the mechanisms of organotin-mediated reactions and their potential applications in material science and medicinal chemistry.
Used in Material Science:
4-oxo-4-[(tributylstannyl)oxy]but-2-enoic acid is utilized in material science for the development of new materials with specific properties. The organotin component can influence the material's stability, reactivity, and other characteristics, making it a candidate for applications such as polymer synthesis or the creation of new catalysts.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-oxo-4-[(tributylstannyl)oxy]but-2-enoic acid may be used as an intermediate in the synthesis of drug molecules. Its unique structure can be incorporated into drug candidates to enhance their pharmacological properties, such as improving their bioavailability or targeting specific biological pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 4027-18-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,0,2 and 7 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 4027-18:
(6*4)+(5*0)+(4*2)+(3*7)+(2*1)+(1*8)=63
63 % 10 = 3
So 4027-18-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H4O4.3C4H9.Sn/c5-3(6)1-2-4(7)8;3*1-3-4-2;/h1-2H,(H,5,6)(H,7,8);3*1,3-4H2,2H3;/b2-1+;;;;/rC12H27Sn.C4H4O4/c1-4-7-10-13(11-8-5-2)12-9-6-3;5-3(6)1-2-4(7)8/h4-12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+
