4029-26-9 Usage
Uses
Used in Organic Synthesis:
2,2-DIMETHYL-4-OXOCYCLOHEXANECARBOXYLIC ACID is used as a building block in organic synthesis for the preparation of various chemical compounds. Its unique structure and functional groups make it a valuable intermediate in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2,2-DIMETHYL-4-OXOCYCLOHEXANECARBOXYLIC ACID is used as a key component in the development of new drugs and medical treatments. Its chemical properties allow it to be incorporated into the molecular structures of pharmacologically active compounds, potentially leading to the discovery of novel therapeutic agents.
Used in Drug Development:
2,2-DIMETHYL-4-OXOCYCLOHEXANECARBOXYLIC ACID may have potential applications in the development of new drugs due to its ability to be modified and incorporated into various molecular frameworks. Its presence in a compound can influence the pharmacokinetic and pharmacodynamic properties, making it a promising candidate for further research and development in the pharmaceutical field.
Check Digit Verification of cas no
The CAS Registry Mumber 4029-26-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,0,2 and 9 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4029-26:
(6*4)+(5*0)+(4*2)+(3*9)+(2*2)+(1*6)=69
69 % 10 = 9
So 4029-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H14O3/c1-9(2)5-6(10)3-4-7(9)8(11)12/h7H,3-5H2,1-2H3,(H,11,12)
