40298-32-6 Usage
Uses
Used in Bioconjugation:
H-SAR-OBZL HCL is used as a reactive compound for bioconjugation, allowing the attachment of other functional groups or labels to proteins or peptides. Its reactivity and specificity make it a preferred choice for creating stable and specific conjugates.
Used in Immunoassays:
In the Diagnostics Industry, H-SAR-OBZL HCL is used as a key component in the production of conjugates for immunoassays. It enables the attachment of signaling molecules or enzymes to antibodies, enhancing the sensitivity and specificity of diagnostic tests.
Used in Targeted Cancer Therapy:
In the Pharmaceutical Industry, H-SAR-OBZL HCL is used as a critical component in the creation of antibody-drug conjugates for targeted cancer therapy. Its ability to form stable linkages between antibodies and cytotoxic drugs allows for the development of therapies that selectively target cancer cells, minimizing damage to healthy tissues.
Overall, H-SAR-OBZL HCL plays a significant role in various applications across different industries, including diagnostics and pharmaceuticals, due to its unique properties and capabilities in bioconjugation and protein modification.
Check Digit Verification of cas no
The CAS Registry Mumber 40298-32-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,2,9 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 40298-32:
(7*4)+(6*0)+(5*2)+(4*9)+(3*8)+(2*3)+(1*2)=106
106 % 10 = 6
So 40298-32-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO2.ClH/c1-11-7-10(12)13-8-9-5-3-2-4-6-9;/h2-6,11H,7-8H2,1H3;1H
