403-80-5 Usage
Uses
Used in Pharmaceutical Research:
3,5-difluoro-N-(4-fluorophenyl)aniline serves as a crucial building block in the development of various pharmaceuticals. Its unique structure allows for the creation of drug candidates with improved biological activity, contributing to advancements in medicinal chemistry.
Used in Agrochemical Research:
In the agrochemical industry, 3,5-difluoro-N-(4-fluorophenyl)aniline is utilized for its potential applications in the synthesis of agrochemicals. Its chemical properties make it a valuable component in developing new compounds for agricultural use.
Used in Organic Synthesis:
3,5-difluoro-N-(4-fluorophenyl)aniline plays a significant role in organic synthesis, particularly in the field of medicinal chemistry. Its structure facilitates the development of new compounds with enhanced biological activity, making it an essential component in the synthesis of innovative drug candidates.
It is important to handle and store 3,5-difluoro-N-(4-fluorophenyl)aniline with caution due to its potential toxicity and hazardous nature if not properly managed.
Check Digit Verification of cas no
The CAS Registry Mumber 403-80-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,0 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 403-80:
(5*4)+(4*0)+(3*3)+(2*8)+(1*0)=45
45 % 10 = 5
So 403-80-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H8F3N/c13-8-1-3-11(4-2-8)16-12-6-9(14)5-10(15)7-12/h1-7,16H
