40321-70-8 Usage
General Description
2,4-Bis(phenylmethoxy)-α-(p-methoxyphenyl)-β-oxobenzenepropanal is a chemical compound with a complex molecular structure. It is a propanal derivative with two phenylmethoxy groups, a p-methoxyphenyl group, and a β-oxobenzene moiety. 2,4-Bis(phenylmethoxy)-α-(p-methoxyphenyl)-β-oxobenzenepropanal is often used in organic synthesis and medicinal chemistry research. Its unique structure and functional groups make it a potentially valuable component in the development of new pharmaceuticals and materials. Additionally, the compound's aromatic nature and functional groups make it a useful building block for creating various organic molecules with specific properties and applications. Further research and study of this chemical may uncover additional potential uses and beneficial properties.
Check Digit Verification of cas no
The CAS Registry Mumber 40321-70-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,3,2 and 1 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 40321-70:
(7*4)+(6*0)+(5*3)+(4*2)+(3*1)+(2*7)+(1*0)=68
68 % 10 = 8
So 40321-70-8 is a valid CAS Registry Number.
InChI:InChI=1/C30H26O5/c1-33-25-14-12-24(13-15-25)28(19-31)30(32)27-17-16-26(34-20-22-8-4-2-5-9-22)18-29(27)35-21-23-10-6-3-7-11-23/h2-19,28H,20-21H2,1H3