40332-25-0 Usage
General Description
N-[(2-Methyl-1H-benzimidazol-1-yl)acetyl]-L-phenylalanine is a chemical compound with the molecular formula C21H20N4O3. It is a derivative of phenylalanine, an essential amino acid, with an additional benzimidazole moiety attached to the acetyl group. N-[(2-Methyl-1H-benzimidazol-1-yl)acetyl]-L-phenylalanine has potential application in the field of pharmaceuticals and medical research due to its benzimidazole group, which is known for its diverse biological activities, including antiviral, antifungal, and anticancer properties. Additionally, the phenylalanine component of the molecule can contribute to its role in protein synthesis and overall physiological function. Overall, N-[(2-Methyl-1H-benzimidazol-1-yl)acetyl]-L-phenylalanine is a compound of interest for further investigation and potential therapeutic development.
Check Digit Verification of cas no
The CAS Registry Mumber 40332-25-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,3,3 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 40332-25:
(7*4)+(6*0)+(5*3)+(4*3)+(3*2)+(2*2)+(1*5)=70
70 % 10 = 0
So 40332-25-0 is a valid CAS Registry Number.
InChI:InChI=1/C20H21N3O3/c1-14-21-16-10-6-7-11-18(16)23(14)13-19(24)22-17(20(25)26-2)12-15-8-4-3-5-9-15/h3-11,17H,12-13H2,1-2H3,(H,22,24)/t17-/m0/s1