40336-81-0 Usage
Uses
Used in Pharmaceutical Synthesis:
4-Diethylaminobenzylamine is used as an intermediate in the synthesis of pharmaceuticals, contributing to the development of various medicinal compounds.
Used in Organic Compound Synthesis:
4-DIETHYLAMINOBENZYLAMINE is utilized as an intermediate in the synthesis of other organic compounds, playing a crucial role in the creation of a wide range of chemical products.
Used as a Reagent in Chemical Reactions:
4-Diethylaminobenzylamine is employed as a reagent in various chemical reactions, such as the formation of amides and esters, facilitating the production of different chemical entities.
Used as a Catalyst in Polymer Synthesis:
In the synthesis of polymers and other industrial processes, 4-Diethylaminobenzylamine serves as a catalyst, enhancing the efficiency and effectiveness of these reactions.
Used as a Corrosion Inhibitor:
4-DIETHYLAMINOBENZYLAMINE is known for its use as a corrosion inhibitor, helping to protect materials from degradation and prolonging their lifespan.
Used as an Additive in Coatings and Adhesives:
4-Diethylaminobenzylamine is also used as an additive in coatings and adhesives, improving their performance and durability.
Check Digit Verification of cas no
The CAS Registry Mumber 40336-81-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,3,3 and 6 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 40336-81:
(7*4)+(6*0)+(5*3)+(4*3)+(3*6)+(2*8)+(1*1)=90
90 % 10 = 0
So 40336-81-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H18N2/c1-3-13(4-2)11-7-5-10(9-12)6-8-11/h5-8H,3-4,9,12H2,1-2H3
