403850-84-0 Usage
Uses
Used in Pharmaceutical Industry:
7-BROMO-4-CHLORO-2-METHYLQUINAZOLINE is used as a chemical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents.
Used in Organic Chemistry:
In the field of organic chemistry, 7-BROMO-4-CHLORO-2-METHYLQUINAZOLINE is utilized as a building block for the creation of more complex organic compounds, facilitating advancements in chemical research and innovation.
Used in Antitumor Research:
7-BROMO-4-CHLORO-2-METHYLQUINAZOLINE is studied for its potential as an antitumor agent, exploring its capacity to inhibit tumor growth and contribute to cancer treatment strategies.
Used in Disease Treatment:
7-BROMO-4-CHLORO-2-METHYLQUINAZOLINE is also considered for its possible applications in the treatment of other diseases, based on its pharmacological properties and potential therapeutic effects.
Check Digit Verification of cas no
The CAS Registry Mumber 403850-84-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,3,8,5 and 0 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 403850-84:
(8*4)+(7*0)+(6*3)+(5*8)+(4*5)+(3*0)+(2*8)+(1*4)=130
130 % 10 = 0
So 403850-84-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H6BrClN2/c1-5-12-8-4-6(10)2-3-7(8)9(11)13-5/h2-4H,1H3
