40397-90-8

Usage

Uses

Used in Polymer Industry:
3-Chloro-2-methylphenyl isocyanate is used as a key component in the production of polyurethane and other polymers, contributing to the formation of various materials with unique properties.
Used in Coatings and Adhesives Industry:
3-Chloro-2-methylphenyl isocyanate is used as a reactive ingredient in the manufacture of coatings and adhesives, enhancing their bonding and durability characteristics.
Used in Sealants Industry:
In the sealants industry, 3-Chloro-2-methylphenyl isocyanate is used to improve the sealing properties of materials, providing better adhesion and resistance to environmental factors.
Used in Polyurethane Foams Industry:
3-Chloro-2-methylphenyl isocyanate is utilized in the production of polyurethane foams, which are known for their versatility and applications in various industries, including furniture, bedding, and insulation.
Used in Pesticides Industry:
3-Chloro-2-methylphenyl isocyanate is used in the production of insecticides and herbicides, where its reactive nature contributes to the effectiveness of these agricultural chemicals.

InChI:InChI=1/C8H6ClNO/c1-6-7(9)3-2-4-8(6)10-5-11/h2-4H,1H3

Upstream product

• 87-60-5 3-chloro-2-methylbenzenamine 

Downstream Products

• 40397-35-1 2-Hydroxy-4,4-dimethyl-6-oxo-cyclohex-1-enecarboxylic acid (3-chloro-2-methyl-phenyl)-amide 
• 32496-28-9 (3-Chloro-2-methyl-phenyl)-carbamic acid 1,1-dimethyl-prop-2-ynyl ester 
• 42755-35-1 1-(3-Chloro-2-methyl-phenyl)-3-(1-methyl-1-phenyl-ethyl)-urea 
• 124421-00-7 1-(3-Chloro-2-methyl-phenyl)-3-pyridin-4-yl-urea 
• 86781-36-4 1,1-Dibutyl-3-(3-chloro-2-methyl-phenyl)-urea 
• 1220811-29-9 1,3a,8-trimethyl-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indol-5-yl 3-chloro-2-methylphenylcarbamate 

Relevant academic research and scientific papers

TETRAZOLINONE COMPOUND AND USE THEREOF

The compound represented by formula (1): wherein R4 and R5 each represents a hydrogen atom, a halogen atom, or a C1-C3 alkyl group; R6 represents a C1-C4 alkyl group, a C3-C6 cycloalkyl group, or the like; R7, R8, and R9 each represents a hydrogen atom, a halogen atom, or the like; R10 represents a C1-C3 alkyl group, or the like; R13 represents a C1-C3 alkyl group, or the like; and Q represents a phenyl group, or the like; has an excellent control effect on pests.

TETRAZOLINONE COMPOUND AND APPLICATIONS THEREOF

Disclosed is a tetrazolinone compound having a high pest control effect and represented by the formula (1): wherein R1, R2, R3, and R11 each represent a halogen atom, a C1-C6 alkyl group, or the like; R4 and R5 each represent a hydrogen atom, a halogen atom, a C1-C3 alkyl group, or the like; R6 represents a C1-C3 alkyl group which may have a halogen atom(s) or the like; R7, R8, and R9 each represent a hydrogen atom, a halogen atom, or the like; R10 represents a C1-C3 alkyl group or the like; R12 represents a C1-C6 alkyl group, a C3-C6 cycloalkyl group, or the like, and R13 represents a C1-C6 alkyl group, a C2-C6 alkenyl group, or the like.

TETRAZOLINONE COMPOUNDS AND ITS USE AS PESTICIDES

The present invention provides a compound having an excellent efficacy for controlling pests. A tetrazolinone compound of a formula (1): [wherein R1 represents an C6-C16 aryl group, an C1-C12 alkyl group, or a C3-C12 cycloalkyl group, etc., which each optionally be substituted; R2, R3, R4 and R5 represent independently of each other a hydrogen atom, a halogen atom or an C1-C3 alkyl group, etc.; R6 represents an C1-C6 alkyl group, a C3-C6 cycloalkyl group, a halogen atom, a C1-C6 haloalkyl group, an C2-C6 alkenyl group, an C1-C6 alkoxy group, or a C1-C6 haloalkoxy group, etc.; R7, R8 and R9 represent independently of each other a hydrogen atom, a halogen atom, or an C1-C4 alkyl group, etc.; X represents an oxygen atom or a sulfur atom; and R10 represents an C1-C6 alkyl group, etc.] shows an excellent controlling efficacy on pests.

TETRAZOLINONE COMPOUNDS AND ITS USE

The present invention provides a compound having an excellent efficacy for controlling pests. A tetrazolinone compound of a formula (1): [wherein, R1 represents an C6-C16 aryl group, an C1-C12 alkyl group, a C3-C12 cycloalkyl group or an adamantyl group, etc., which each optionally be substituted; R2 represents a hydrogen atom, an C1-C12 alkyl group, or a halogen atom, etc.; R4 and R5 represent independently of each other a hydrogen atom or an C1-C3 alkyl group, etc.; R6, R7, R8 and R9 represent independently of each other a hydrogen atom, a halogen atom, an C1-C12 alkyl group, a C1-C12 haloalkyl group, an C2-C12 alkenyl group, a C3-C12 cycloalkyl group, an C1-C12 alkoxy group or a C1-C12 haloalkoxy group, etc.; X and Y represent independently of each other a sulfur atom or an oxygen atom; Q represents an oxygen atom or a sulfur atom; and R10 represents an C1-C6 alkyl group, etc.] shows an excellent controlling efficacy on pests.