40469-87-2 Usage
Description
3-AMINO-4-METHYLHEXANOIC ACID, also known as 4-Methyl-3-aminocaproic acid, is an amino acid derivative with the molecular formula C7H15NO2. It is a chemical compound that has gained attention for its potential applications in the pharmaceutical industry due to its ability to inhibit fibrinolysis, which is the process of breaking down blood clots.
Uses
Used in Pharmaceutical Industry:
3-AMINO-4-METHYLHEXANOIC ACID is used as a pharmaceutical intermediate for its ability to inhibit fibrinolysis, making it a potential treatment for excessive bleeding conditions. It is particularly useful in managing conditions that involve abnormal blood clotting or hemorrhage.
3-AMINO-4-METHYLHEXANOIC ACID is also used as a component in the synthesis of various pharmaceuticals, contributing to the development of new medications with diverse therapeutic applications.
Furthermore, 3-AMINO-4-METHYLHEXANOIC ACID has been studied for its potential in promoting blood clotting and reducing postoperative blood loss, which can be beneficial in surgical settings to minimize complications and improve patient outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 40469-87-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,4,6 and 9 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 40469-87:
(7*4)+(6*0)+(5*4)+(4*6)+(3*9)+(2*8)+(1*7)=122
122 % 10 = 2
So 40469-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H15NO2/c1-3-5(2)6(8)4-7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t5-,6-/m1/s1