40504-78-7 Usage
Oxazolinone derivative
It belongs to the class of chemical compounds called oxazolinones, which are known for their potential applications in medicinal chemistry.
Contains a butynylamino group
The compound has a butynylamino group (a functional group with a triple-bonded carbon atom and an amino group) attached to it, which contributes to its chemical reactivity and potential applications.
Contains a phenyl group
The presence of a phenyl group (a ring of six carbon atoms with a single bond to a hydrogen atom) in the compound provides stability and versatility for further chemical reactions.
Potential applications in medicinal chemistry
Due to its unique structure and functional groups, 2-(3-Butynylamino)-5-phenyl-2-oxazolin-4-one can be used in the development of pharmaceuticals and bioactive molecules.
Versatile building block for synthesis
The compound's structure allows it to be used as a building block in the synthesis of various organic compounds, making it a valuable resource in organic chemistry.
Possible biological activities
2-(3-Butynylamino)-5-phenyl-2-oxazolin-4-one may exhibit biological activities that could be of interest for further research and development, particularly in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 40504-78-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,5,0 and 4 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 40504-78:
(7*4)+(6*0)+(5*5)+(4*0)+(3*4)+(2*7)+(1*8)=87
87 % 10 = 7
So 40504-78-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2O2/c1-2-3-9-14-13-15-12(16)11(17-13)10-7-5-4-6-8-10/h1,4-8,11H,3,9H2,(H,14,15,16)
