40548-90-1 Usage
Uses
Used in Pharmaceutical Industry:
5-Amino-4,6-dimethyl-nicotinonitrile is used as a key intermediate in the synthesis of various pharmaceuticals for its potential to contribute to the development of new drugs. Its role in medicinal chemistry is highlighted by its potential biological and pharmacological properties, which are currently under investigation for their applicability in treating different diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Amino-4,6-dimethyl-nicotinonitrile is utilized as an intermediate in the production of agrochemicals. Its chemical structure makes it a valuable component in the synthesis of compounds that can be used in agricultural applications, such as pesticides or herbicides, to enhance crop protection and yield.
Used in Medicinal Chemistry Research:
5-Amino-4,6-dimethyl-nicotinonitrile is employed as a subject of study in medicinal chemistry research. Scientists are exploring its potential biological properties to understand its implications in drug development, with the aim of discovering new therapeutic agents that can be used to combat various health issues.
Check Digit Verification of cas no
The CAS Registry Mumber 40548-90-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,5,4 and 8 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 40548-90:
(7*4)+(6*0)+(5*5)+(4*4)+(3*8)+(2*9)+(1*0)=111
111 % 10 = 1
So 40548-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3/c1-5-7(3-9)4-11-6(2)8(5)10/h4H,10H2,1-2H3
