40548-90-1 Usage
General Description
5-Amino-4,6-dimethyl-nicotinonitrile is a chemical compound with the molecular formula C8H10N4. It is a yellow solid with a faint odor, and it is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. 5-AMINO-4,6-DIMETHYL-NICOTINONITRILE is also being studied for its potential biological and pharmacological properties, particularly in the field of medicinal chemistry. Additionally, it has been reported to have potential applications in the development of new drugs for various diseases and conditions. Overall, 5-amino-4,6-dimethyl-nicotinonitrile is an important building block in the synthesis of various compounds with potential pharmaceutical and agrochemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 40548-90-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,5,4 and 8 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 40548-90:
(7*4)+(6*0)+(5*5)+(4*4)+(3*8)+(2*9)+(1*0)=111
111 % 10 = 1
So 40548-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3/c1-5-7(3-9)4-11-6(2)8(5)10/h4H,10H2,1-2H3
