405933-98-4 Usage
Uses
Used in Chemical Research:
2-(4-Bromo-phenyl)-4,6-dichloro-quinazoline is used as an intermediate compound for the synthesis of more complex molecules, facilitating the creation of new chemical entities with potential applications in various fields.
Used in Medicinal Chemistry Studies:
In the field of medicinal chemistry, 2-(4-Bromo-phenyl)-4,6-dichloro-quinazoline is used as a potential bioactive molecule. Its unique structure and properties make it a candidate for further investigation into its therapeutic potential, possibly leading to the development of new drugs.
Used in Pharmaceutical Industry:
2-(4-Bromo-phenyl)-4,6-dichloro-quinazoline is used as a key component in the development of pharmaceuticals, particularly in the design and synthesis of novel drug candidates that could target specific biological pathways or receptors. Its halogenated nature may contribute to its interaction with biological targets, making it a valuable asset in drug discovery processes.
Check Digit Verification of cas no
The CAS Registry Mumber 405933-98-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,5,9,3 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 405933-98:
(8*4)+(7*0)+(6*5)+(5*9)+(4*3)+(3*3)+(2*9)+(1*8)=154
154 % 10 = 4
So 405933-98-4 is a valid CAS Registry Number.
InChI:InChI=1S/C14H7BrCl2N2/c15-9-3-1-8(2-4-9)14-18-12-6-5-10(16)7-11(12)13(17)19-14/h1-7H
