406920-75-0 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
(3S)-(+)-3-(1-METHYL-1H-INDOL-3-YL)-1-BUTYRALDEHYDE is utilized as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its chiral structure allows for the development of enantiomerically pure compounds, which is vital for ensuring the desired biological activity and minimizing potential side effects in drugs.
Used in Fragrance and Flavor Industry:
In the fragrance and flavor industry, (3S)-(+)-3-(1-METHYL-1H-INDOL-3-YL)-1-BUTYRALDEHYDE is employed as a scent component due to the characteristic odor imparted by its indole group. This makes it suitable for use in creating perfumes, colognes, and other scented products where a unique and pleasant aroma is desired.
Used in Synthesis of Enantiomerically Pure Substances:
(3S)-(+)-3-(1-METHYL-1H-INDOL-3-YL)-1-BUTYRALDEHYDE is used as a valuable building block in the preparation of enantiomerically pure substances. Its chiral nature is crucial for applications requiring specific stereochemistry, such as in drug development where the desired therapeutic effect and minimization of side effects are dependent on the compound's stereochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 406920-75-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,6,9,2 and 0 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 406920-75:
(8*4)+(7*0)+(6*6)+(5*9)+(4*2)+(3*0)+(2*7)+(1*5)=140
140 % 10 = 0
So 406920-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO/c1-10(7-8-15)12-9-14(2)13-6-4-3-5-11(12)13/h3-6,8-10H,7H2,1-2H3/t10-/m0/s1
