4078-55-1 Usage
General Description
2-AMINOETHYL-5(6)-METHOXY-BENZIMIDAZOLE is a chemical compound that belongs to the benzimidazole family. It is a benzimidazole derivative with a methoxy group at the 5 or 6 position and an aminoethyl group. 2-AMINOETHYL-5(6)-METHOXY-BENZIMIDAZOLE has been studied for its potential pharmacological properties, including as a potential antineoplastic agent. It has also been explored for its potential role in the treatment of various diseases, such as cancer and autoimmune disorders. Additionally, it has been investigated for its potential use as a fluorescent probe in biological imaging studies. Overall, 2-AMINOETHYL-5(6)-METHOXY-BENZIMIDAZOLE has shown promise as a versatile and potentially valuable chemical compound in various fields of research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 4078-55-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,0,7 and 8 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 4078-55:
(6*4)+(5*0)+(4*7)+(3*8)+(2*5)+(1*5)=91
91 % 10 = 1
So 4078-55-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3O.2ClH/c1-14-7-2-3-8-9(6-7)13-10(12-8)4-5-11;;/h2-3,6H,4-5,11H2,1H3,(H,12,13);2*1H
