40785-62-4 Usage
Description
1,3,3a,4,5,6,7,8,9,10,11,13a-dodecahydrocyclododeca[c]furan is a synthetic chemical compound characterized by its rigid 12-membered ring structure. It is a saturated cyclic ether known for its high boiling point and insolubility in water. 1,3,3a,4,5,6,7,8,9,10,11,13a-dodecahydrocyclododeca[c]furan is commonly utilized as a solvent in chemical reactions and serves as a precursor in the synthesis of other chemicals.
Uses
Used in Chemical Reactions:
1,3,3a,4,5,6,7,8,9,10,11,13a-dodecahydrocyclododeca[c]furan is used as a solvent in various chemical reactions due to its unique properties, facilitating the process and enhancing the efficiency of these reactions.
Used in Chemical Synthesis:
As a precursor, 1,3,3a,4,5,6,7,8,9,10,11,13a-dodecahydrocyclododeca[c]furan plays a crucial role in the production of other chemicals, contributing to the development of new compounds and materials.
Used in Industrial Applications:
The high boiling point and insolubility in water of 1,3,3a,4,5,6,7,8,9,10,11,13a-dodecahydrocyclododeca[c]furan make it suitable for specific industrial applications where these characteristics are advantageous.
Check Digit Verification of cas no
The CAS Registry Mumber 40785-62-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,7,8 and 5 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 40785-62:
(7*4)+(6*0)+(5*7)+(4*8)+(3*5)+(2*6)+(1*2)=124
124 % 10 = 4
So 40785-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H24O/c1-2-4-6-8-10-14-12-15-11-13(14)9-7-5-3-1/h7,9,13-14H,1-6,8,10-12H2/b9-7-
