408309-29-5 Usage
Uses
Used in Pharmaceutical Industry:
3-(1H-pyrrol-2-yl)propanoic acid is utilized as a key intermediate in the synthesis of various pharmaceutical compounds due to its unique heterocyclic structure. Its presence in the molecular framework can influence the pharmacokinetic and pharmacodynamic properties of the resulting drugs, potentially enhancing their efficacy and selectivity.
Used in Organic Synthesis:
In the realm of organic synthesis, 3-(1H-pyrrol-2-yl)propanoic acid serves as a versatile building block for the creation of complex organic molecules. Its reactivity and structural features allow for the development of novel chemical entities with potential applications in various fields, including materials science, agrochemicals, and specialty chemicals.
Used in Medicinal Chemistry Research:
3-(1H-pyrrol-2-yl)propanoic acid is employed as a subject of study in medicinal chemistry, where its biological activities are explored. Researchers investigate its interactions with biological targets, such as enzymes, receptors, or ion channels, to understand its potential therapeutic effects and mechanisms of action. This knowledge can guide the design of new drugs with improved properties.
Used in Drug Development:
In the drug development process, 3-(1H-pyrrol-2-yl)propanoic acid may be incorporated into lead compounds or serve as a template for the design of new pharmaceutical agents. Its unique structural elements can be leveraged to optimize drug candidates, enhancing their potency, selectivity, and safety profiles, ultimately contributing to the advancement of novel therapeutics for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 408309-29-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,8,3,0 and 9 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 408309-29:
(8*4)+(7*0)+(6*8)+(5*3)+(4*0)+(3*9)+(2*2)+(1*9)=135
135 % 10 = 5
So 408309-29-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO2/c9-7(10)4-3-6-2-1-5-8-6/h1-2,5,8H,3-4H2,(H,9,10)
408309-29-5Relevant academic research and scientific papers
Hydroxy and amino functional pyrrolizidine catalyst compositions for the production of polyurethanes
-
, (2008/06/13)
A method for preparing a polyurethane foam which comprises reacting an organic polyisocyanate and a polyol in the presence of a blowing agent, cell stabilizer and a catalyst composition consisting essentially of a pyrrolizidine of the formula: STR1 where R1 and R2 independently are --H, --OH, STR2 or --NR4 R5, R3 is hydrogen, a C1 -C12 alkyl, C5 -C6 cycloalkyl, C6 -C10 aryl, or C7 -C11 arylalkyl group, and R4 and R5 independently represent H, a C1 -C12 alkyl group, C5 -C10 cycloalkyl, C6 -C10 aryl, or C7 -C11 arylalkyl group, provided that at least R1 or R2 is not hydrogen.
