408352-90-9 Usage
Uses
Used in Pharmaceutical Industry:
C-(2-phenyl-oxazol-4-yl)-methylamine is used as a building block or intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with specific therapeutic properties, such as targeting particular receptors or enzymes involved in disease processes.
Used in Agrochemical Industry:
In the agrochemical industry, C-(2-phenyl-oxazol-4-yl)-methylamine may be utilized as a precursor for the development of novel agrochemicals, such as pesticides or herbicides. Its chemical properties can be exploited to create compounds with enhanced efficacy and selectivity, leading to more effective and environmentally friendly agricultural products.
Used in Materials Science:
C-(2-phenyl-oxazol-4-yl)-methylamine's unique structure and properties can also be applied in materials science for the development of new materials with specific characteristics. For example, it may be used in the synthesis of polymers, coatings, or other materials with tailored properties, such as improved stability, conductivity, or biocompatibility.
Check Digit Verification of cas no
The CAS Registry Mumber 408352-90-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,0,8,3,5 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 408352-90:
(8*4)+(7*0)+(6*8)+(5*3)+(4*5)+(3*2)+(2*9)+(1*0)=139
139 % 10 = 9
So 408352-90-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O/c11-6-9-7-13-10(12-9)8-4-2-1-3-5-8/h1-5,7H,6,11H2
