40971-35-5 Usage
Uses
Used in Research and Development:
1,2,3,4-Tetrahydro-quinoline-2-carboxylic acid methyl ester is used as a chemical compound in research and development for various experiments and formulation studies. Its unique structure and properties make it a valuable component in the synthesis of new compounds and the investigation of chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 40971-35-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,9,7 and 1 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 40971-35:
(7*4)+(6*0)+(5*9)+(4*7)+(3*1)+(2*3)+(1*5)=115
115 % 10 = 5
So 40971-35-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO2/c1-14-11(13)10-7-6-8-4-2-3-5-9(8)12-10/h2-5,10,12H,6-7H2,1H3
