41066-08-4 Usage
General Description
NEOCUPROINE HYDROCHLORIDE, also known as 2,9-dimethyl-1,10-phenanthroline hydrochloride, is a chemical compound commonly used in analytical chemistry and in the field of biochemistry. It is a chelating agent that forms stable complexes with transition metals, particularly copper, and is often used in the determination of copper in various samples. The compound has also been studied for its potential applications in the development of new drugs and pharmaceuticals due to its ability to bind with metal ions and its potential anticancer and antiviral properties. Additionally, NEOCUPROINE HYDROCHLORIDE has been utilized in the synthesis of various organic compounds and as a reagent in organic reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 41066-08-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,0,6 and 6 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 41066-08:
(7*4)+(6*1)+(5*0)+(4*6)+(3*6)+(2*0)+(1*8)=84
84 % 10 = 4
So 41066-08-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N2.ClH/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h3-8H,1-2H3;1H