41066-08-4 Usage
Uses
Used in Analytical Chemistry:
NEOCUPROINE HYDROCHLORIDE is used as a chelating agent for the determination of copper in various samples, forming stable complexes that facilitate accurate measurement and analysis.
Used in Pharmaceutical Development:
NEOCUPROINE HYDROCHLORIDE is used as a potential candidate in the development of new drugs and pharmaceuticals due to its ability to bind with metal ions, which may contribute to its anticancer and antiviral properties.
Used in Organic Synthesis:
NEOCUPROINE HYDROCHLORIDE is used as a reagent in the synthesis of various organic compounds, playing a crucial role in chemical reactions and the production of desired products.
Check Digit Verification of cas no
The CAS Registry Mumber 41066-08-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,0,6 and 6 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 41066-08:
(7*4)+(6*1)+(5*0)+(4*6)+(3*6)+(2*0)+(1*8)=84
84 % 10 = 4
So 41066-08-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N2.ClH/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h3-8H,1-2H3;1H