4114-00-5 Usage
Uses
Used in Pharmaceutical Applications:
1(2H)-Pyrimidinepentanoic acid, 3,4-dihydro-2,4-dioxois used as a key component in the development of pharmaceutical drugs due to its unique chemical structure and properties. Its involvement in metabolic pathways and its potential to interact with various biological molecules make it a valuable asset in the creation of new therapeutic agents.
Used in Drug Development:
In the field of drug development, 1(2H)-Pyrimidinepentanoic acid, 3,4-dihydro-2,4-dioxois utilized as a starting material or intermediate for the synthesis of various pharmaceutical compounds. Its versatility and reactivity allow for the creation of a diverse range of molecules with potential therapeutic applications.
Used in Research:
1(2H)-Pyrimidinepentanoic acid, 3,4-dihydro-2,4-dioxois also employed as a research tool in the study of biological processes and metabolic pathways. Its presence in living organisms and its ability to interact with different molecules make it an essential compound for understanding the underlying mechanisms of various biological functions.
Used in Chemical Synthesis:
In the chemical industry, 1(2H)-Pyrimidinepentanoic acid, 3,4-dihydro-2,4-dioxois used as a building block for the synthesis of a wide range of chemical products. Its unique functional groups and reactivity enable the creation of various compounds with different applications, such as specialty chemicals, materials, and intermediates for further chemical reactions.
Used in Biotechnology:
1(2H)-Pyrimidinepentanoic acid, 3,4-dihydro-2,4-dioxois also utilized in the biotechnology sector, where it can be employed as a substrate or catalyst in various biological reactions. Its involvement in metabolic pathways and its ability to interact with biological molecules make it a valuable tool for the development of new biotechnological processes and products.
Check Digit Verification of cas no
The CAS Registry Mumber 4114-00-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,1,1 and 4 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 4114-00:
(6*4)+(5*1)+(4*1)+(3*4)+(2*0)+(1*0)=45
45 % 10 = 5
So 4114-00-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O4/c12-7-4-6-11(9(15)10-7)5-2-1-3-8(13)14/h4,6H,1-3,5H2,(H,13,14)(H,10,12,15)
4114-00-5Relevant academic research and scientific papers
Makinsky,Kritzyn,Uljanova,Zakharova,Nevinsky
, p. 662 - 668 (2000)
N1-Acyclic derivatives of pyrimidine bases (uracil, thymine, and cytosine) with hydrophobic polymethylene chains containing various functional groups in an ω-position of the alkyl substituent were synthesized. Their physicochemical properties and inhibitory effect on the HIV reverse transcriptase and human DNA topoisomerase I were studied.