4115-63-3 Usage
Uses
Used in Organic Synthesis:
Methyl 3-Acetamido-4,6-O-benzylidene-2,3-dideoxy-α-D-arabino-hexopyranoside is used as a synthetic building block for the creation of more complex organic molecules. Its unique structure, which includes an acetamido group and a benzylidene moiety, allows it to participate in various chemical reactions, such as condensation, substitution, and rearrangement reactions, leading to the formation of novel compounds with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Methyl 3-Acetamido-4,6-O-benzylidene-2,3-dideoxy-α-D-arabino-hexopyranoside is used as a key intermediate in the synthesis of various bioactive compounds, including potential drug candidates. Its ability to form diverse chemical structures makes it a valuable asset in the development of new medications, particularly those targeting complex diseases.
Used in Chemical Research:
Methyl 3-Acetamido-4,6-O-benzylidene-2,3-dideoxy-α-D-arabino-hexopyranoside is also employed in academic and industrial research settings as a model compound for studying various aspects of organic chemistry, such as reaction mechanisms, stereochemistry, and the influence of functional groups on reactivity. Its unique structure provides researchers with valuable insights into the behavior of similar compounds and can help guide the design of new synthetic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 4115-63-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,1,1 and 5 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 4115-63:
(6*4)+(5*1)+(4*1)+(3*5)+(2*6)+(1*3)=63
63 % 10 = 3
So 4115-63-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H21NO5/c1-10(18)17-12-8-14(19-2)21-13-9-20-16(22-15(12)13)11-6-4-3-5-7-11/h3-7,12-16H,8-9H2,1-2H3,(H,17,18)
