4117-92-4 Usage
Uses
Used in Chemical Synthesis:
2,2-dimethyl-1,3,2-oxathiastannolan-5-one is used as a precursor for the synthesis of other organotin compounds. Its unique structure allows for the formation of various organotin derivatives, which can be utilized in different applications.
Used in Organic Synthesis:
2,2-dimethyl-1,3,2-oxathiastannolan-5-one is used as a reagent in organic synthesis. Its chemical properties enable it to participate in various reactions, contributing to the formation of complex organic molecules.
Used in Materials Science:
2,2-dimethyl-1,3,2-oxathiastannolan-5-one is used as a component in the development of new materials. Its structural and chemical properties may contribute to the creation of materials with unique characteristics, such as improved mechanical strength or thermal stability.
Used in Catalysis:
2,2-dimethyl-1,3,2-oxathiastannolan-5-one is used as a catalyst or catalyst precursor in various chemical reactions. Its ability to facilitate reactions may lead to more efficient and environmentally friendly processes in the chemical industry.
However, it is important to note that the use of 2,2-dimethyl-1,3,2-oxathiastannolan-5-one may be limited due to the toxicity and environmental concerns associated with some organotin compounds. Proper handling, disposal, and regulatory compliance are essential when working with 2,2-dimethyl-1,3,2-oxathiastannolan-5-one.
Check Digit Verification of cas no
The CAS Registry Mumber 4117-92-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,1,1 and 7 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4117-92:
(6*4)+(5*1)+(4*1)+(3*7)+(2*9)+(1*2)=74
74 % 10 = 4
So 4117-92-4 is a valid CAS Registry Number.
InChI:InChI=1/C2H4O2S.2CH3.Sn/c3-2(4)1-5;;;/h5H,1H2,(H,3,4);2*1H3;/q;;;+2/p-2/rC4H8O2SSn/c1-8(2)6-4(5)3-7-8/h3H2,1-2H3
