41230-63-1 Usage
Uses
Used in Pharmaceutical Industry:
Acetamide, N-(4-amino-3-methyl-5-isoxazolyl)(9CI) is used as a building block for the development of new pharmaceutical compounds. Its unique structure and functional groups make it a valuable component in the synthesis of drugs with specific therapeutic properties.
Used in Research Applications:
In the field of research, Acetamide, N-(4-amino-3-methyl-5-isoxazolyl)(9CI) serves as an intermediate in the synthesis of various compounds. Its presence in these compounds can help researchers explore new chemical reactions, mechanisms, and potential applications in different areas of science.
Used in Drug Synthesis:
Acetamide, N-(4-amino-3-methyl-5-isoxazolyl)(9CI) is used as a key intermediate in the synthesis of drugs with specific therapeutic targets. Its unique structure allows for the development of compounds with improved pharmacological properties, such as increased potency, selectivity, and bioavailability.
Used in Medicinal Chemistry:
In medicinal chemistry, Acetamide, N-(4-amino-3-methyl-5-isoxazolyl)(9CI) is employed as a versatile building block for the design and synthesis of novel bioactive molecules. Its presence in these molecules can contribute to the modulation of biological targets, leading to the development of new therapeutic agents with potential applications in various diseases and conditions.
Overall, Acetamide, N-(4-amino-3-methyl-5-isoxazolyl)(9CI) is a valuable chemical compound with diverse applications in the pharmaceutical and research industries. Its unique structure and functional groups make it an essential component in the development of new drugs and compounds with potential therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 41230-63-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,2,3 and 0 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 41230-63:
(7*4)+(6*1)+(5*2)+(4*3)+(3*0)+(2*6)+(1*3)=71
71 % 10 = 1
So 41230-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3O2/c1-3-5(7)6(11-9-3)8-4(2)10/h7H2,1-2H3,(H,8,10)
