412334-17-9 Usage
Description
N4,Na,Na,Ne,Ne-[Pentakis(carboxymethyl)]-N4-(carboxymethyl)-2,6-diamino-4-azahexanoic Hydrazide, a derivative of diethylenetriaminepentaacetic acid (DTPA), is a bifunctional chelating agent with significant applications in the development of radiopharmaceuticals and contrast agents. Its unique chemical structure allows for the formation of stable complexes with various metal ions, making it a valuable compound in the medical and pharmaceutical industries.
Uses
Used in Radiopharmaceutical Development:
N4,Na,Na,Ne,Ne-[Pentakis(carboxymethyl)]-N4-(carboxymethyl)-2,6-diamino-4-azahexanoic Hydrazide is used as a bifunctional chelating agent for the development of radiopharmaceuticals. Its ability to form stable complexes with metal ions allows for the creation of radiotracers that can be used in diagnostic imaging and targeted therapy.
Used in Contrast Agent Development:
N4,Na,Na,Ne,Ne-[Pentakis(carboxymethyl)]-N4-(carboxymethyl)-2,6-diamino-4-azahexanoic Hydrazide is also used as a bifunctional chelating agent in the development of contrast agents. These agents are essential in medical imaging techniques, such as magnetic resonance imaging (MRI) and computed tomography (CT), to enhance the visualization of specific tissues or organs and improve the accuracy of diagnostic procedures.
Check Digit Verification of cas no
The CAS Registry Mumber 412334-17-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,1,2,3,3 and 4 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 412334-17:
(8*4)+(7*1)+(6*2)+(5*3)+(4*3)+(3*4)+(2*1)+(1*7)=99
99 % 10 = 9
So 412334-17-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H25N5O11/c16-17-15(31)9(20(7-13(27)28)8-14(29)30)3-18(4-10(21)22)1-2-19(5-11(23)24)6-12(25)26/h9H,1-8,16H2,(H,17,31)(H,21,22)(H,23,24)(H,25,26)(H,27,28)(H,29,30)