41319-88-4 Usage
General Description
The chemical [3-chloro-4-(octadecyloxy)phenyl]hydrazono]malononitrile is a complex compound that consists of a chloro-substituted phenyl ring with an attached octadecyloxy group and a hydrazono functional group. It also contains a malononitrile moiety. This chemical has potential applications in organic synthesis and materials science due to its unique structure and properties. Its precise uses and effects would depend on the specific context in which it is employed, and further research and analysis would be needed to fully understand its potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 41319-88-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,3,1 and 9 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 41319-88:
(7*4)+(6*1)+(5*3)+(4*1)+(3*9)+(2*8)+(1*8)=104
104 % 10 = 4
So 41319-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C27H41ClN4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-33-27-19-18-24(21-26(27)28)31-32-25(22-29)23-30/h18-19,21,31H,2-17,20H2,1H3