41333-49-7 Usage
Uses
Used in Organic Synthesis:
2,5-dimethoxy-4-(morpholin-4-yl)benzenediazonium hexafluorophosphate is used as a reactive intermediate in organic synthesis for the preparation of various organic molecules. Its diazonium cation allows for versatile chemical reactions, making it a valuable component in the synthesis of complex organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,5-dimethoxy-4-(morpholin-4-yl)benzenediazonium hexafluorophosphate is used as a precursor for the synthesis of pharmaceutical compounds. Its unique structure and reactivity enable the creation of new drug candidates with potential therapeutic applications.
Used in Chemical Research:
2,5-dimethoxy-4-(morpholin-4-yl)benzenediazonium hexafluorophosphate is utilized in chemical research as a model compound to study the properties and reactions of diazonium compounds. Its reactivity and structural features provide insights into the behavior of similar compounds and contribute to the advancement of chemical knowledge.
Used in Material Science:
In material science, 2,5-dimethoxy-4-(morpholin-4-yl)benzenediazonium hexafluorophosphate is employed in the development of new materials with specific properties. Its reactivity allows for the formation of novel compounds that can be used in the creation of advanced materials for various applications, such as sensors, catalysts, or functional coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 41333-49-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,3,3 and 3 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 41333-49:
(7*4)+(6*1)+(5*3)+(4*3)+(3*3)+(2*4)+(1*9)=87
87 % 10 = 7
So 41333-49-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N3O3.F6P/c1-16-11-8-10(15-3-5-18-6-4-15)12(17-2)7-9(11)14-13;1-7(2,3,4,5)6/h7-8H,3-6H2,1-2H3;/q+1;-1
