41426-11-3 Usage
Uses
Used in Organic Synthesis:
Ethyl 1-ethyl-2-(ethylthio)naphtho[1,2-d]thiazolium sulphate serves as a valuable intermediate in organic synthesis, particularly for the creation of novel compounds with unique properties. Its complex structure allows for various chemical reactions, making it a versatile building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, ethyl 1-ethyl-2-(ethylthio)naphtho[1,2-d]thiazolium sulphate is utilized as a key component in the development of new drugs. Its unique structure and reactivity can contribute to the design of innovative therapeutic agents with improved efficacy and selectivity. ethyl 1-ethyl-2-(ethylthio)naphtho[1,2-d]thiazolium sulphate may also play a role in the synthesis of prodrugs or drug delivery systems, enhancing the bioavailability and targeting of active pharmaceutical ingredients.
Used in Materials Science:
Ethyl 1-ethyl-2-(ethylthio)naphtho[1,2-d]thiazolium sulphate also finds applications in materials science, where its distinctive chemical and physical properties can be harnessed to develop new materials with specific functions. These may include advanced polymers, sensors, or other materials with tailored properties for use in various industries, such as electronics, energy, or environmental management.
Due to the compound's complexity and potential reactivity, it is crucial to conduct thorough research and investigation to fully understand its potential applications and risks. This will ensure the safe and effective use of ethyl 1-ethyl-2-(ethylthio)naphtho[1,2-d]thiazolium sulphate in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 41426-11-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,4,2 and 6 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 41426-11:
(7*4)+(6*1)+(5*4)+(4*2)+(3*6)+(2*1)+(1*1)=83
83 % 10 = 3
So 41426-11-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H16NS2.C2H6O4S/c1-3-16-14-12-8-6-5-7-11(12)9-10-13(14)18-15(16)17-4-2;1-2-6-7(3,4)5/h5-10H,3-4H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1
