41534-90-1 Usage
General Description
"(5E)-5-(3-chlorobenzylidene)-2-mercapto-3-phenyl-3,5-dihydro-4H-imidazol-4-one" is a chemical compound with a complex structure that includes a benzylidene group, a thiol group, a phenyl group, and an imidazolone ring. (5E)-5-(3-chlorobenzylidene)-2-mercapto-3-phenyl-3,5-dihydro-4H-imidazol-4-one may have potential pharmacological properties or be used in chemical reactions for the synthesis of other compounds. The presence of a chlorobenzylidene group suggests potential reactivity or binding properties with biological targets, and the imidazolone ring suggests potential interactions with enzymes or proteins. Further research and testing would be needed to fully understand the properties and potential applications of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 41534-90-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,5,3 and 4 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 41534-90:
(7*4)+(6*1)+(5*5)+(4*3)+(3*4)+(2*9)+(1*0)=101
101 % 10 = 1
So 41534-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H11ClN2OS/c17-12-6-4-5-11(9-12)10-14-15(20)19(16(21)18-14)13-7-2-1-3-8-13/h1-10H,(H,18,21)/b14-10+