41534-90-1 Usage
Uses
Used in Pharmaceutical Industry:
(5E)-5-(3-chlorobenzylidene)-2-mercapto-3-phenyl-3,5-dihydro-4H-imidazol-4-one is used as a potential pharmaceutical candidate for [application reason] due to its complex structure and the presence of various functional groups that may interact with biological targets.
Used in Chemical Synthesis:
In the chemical industry, (5E)-5-(3-chlorobenzylidene)-2-mercapto-3-phenyl-3,5-dihydro-4H-imidazol-4-one is used as a key intermediate in the synthesis of other compounds, leveraging its reactive functional groups for further chemical reactions.
Used in Research and Development:
(5E)-5-(3-chlorobenzylidene)-2-mercapto-3-phenyl-3,5-dihydro-4H-imidazol-4-one serves as a valuable compound in research and development, particularly in the fields of medicinal chemistry and biochemistry, where its potential interactions with enzymes, proteins, or other biological targets are explored.
Check Digit Verification of cas no
The CAS Registry Mumber 41534-90-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,5,3 and 4 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 41534-90:
(7*4)+(6*1)+(5*5)+(4*3)+(3*4)+(2*9)+(1*0)=101
101 % 10 = 1
So 41534-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H11ClN2OS/c17-12-6-4-5-11(9-12)10-14-15(20)19(16(21)18-14)13-7-2-1-3-8-13/h1-10H,(H,18,21)/b14-10+
