41576-36-7 Usage
General Description
2,5-bis[(methylphenyl)amino]terephthalic acid is a chemical compound with a molecular formula C24H19N3O4. It is a derivative of terephthalic acid, a common building block in the production of polymers and plastics. 2,5-bis[(methylphenyl)amino]terephthalic acid contains two amino groups and two methylphenyl groups attached to the terephthalic acid backbone. 2,5-bis[(methylphenyl)amino]terephthalic acid is often used in the production of photoconductive materials for electrophotography and organic light-emitting diodes (OLEDs), as well as in the synthesis of dyes and pigments. Its unique molecular structure gives it specific properties that make it valuable in various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 41576-36-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,5,7 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 41576-36:
(7*4)+(6*1)+(5*5)+(4*7)+(3*6)+(2*3)+(1*6)=117
117 % 10 = 7
So 41576-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C22H20N2O4/c1-13-7-3-5-9-17(13)23-19-11-16(22(27)28)20(12-15(19)21(25)26)24-18-10-6-4-8-14(18)2/h3-12,23-24H,1-2H3,(H,25,26)(H,27,28)