41611-98-7 Usage
Preparation
Aniline and 3-Hydroxy-7-methoxy-2-naphthoic acid?condensation.
Check Digit Verification of cas no
The CAS Registry Mumber 41611-98-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,6,1 and 1 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 41611-98:
(7*4)+(6*1)+(5*6)+(4*1)+(3*1)+(2*9)+(1*8)=97
97 % 10 = 7
So 41611-98-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H15NO3/c1-22-15-8-7-12-11-17(20)16(10-13(12)9-15)18(21)19-14-5-3-2-4-6-14/h2-11,20H,1H3,(H,19,21)
41611-98-7Relevant academic research and scientific papers
Photogenerating azo pigments
-
, (2008/06/13)
A photogenerating pigment has the formula: wherein A is the residual structure of an aromatic amine, p is an integer 1, 2, 3, 4, etc. depending on the amine structure, m is an integer 0, 1, 2, 3, or 4 and X may be selected from the group including but not limited to F, Cl, Br, NO2, CN, OH, NH2, OCH3, OCH2CH3, CF3, alkyl and aromatic groups.
