41741-86-0 Usage
Description
Sodium bis[2-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]benzoato(2-)]chromate(1-) is a complex chromate compound that consists of a central chromium atom surrounded by two organic ligands, sodium, and carries a negative charge. sodium bis[2-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]benzoato(2-)]chromate(1-) is known for its applications in industrial settings, particularly as a corrosion inhibitor and a dye, due to its unique chemical properties.
Uses
Used in Corrosion Inhibition Applications:
Sodium bis[2-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]benzoato(2-)]chromate(1-) is used as a corrosion inhibitor to protect metal surfaces from degradation and wear in various industrial processes. Its effectiveness in preventing corrosion is attributed to the formation of a protective layer on metal surfaces, thereby reducing the rate of chemical or electrochemical reactions that lead to corrosion.
Used in Dye Industry:
In the dye industry, sodium bis[2-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]benzoato(2-)]chromate(1-) is utilized as a dye due to its color-producing properties. Its ability to impart color to various materials makes it a valuable component in the production of pigments and dyes for textiles, plastics, and other applications where coloration is required.
Used in Environmental Management:
Given its potential toxicity to humans and the environment, sodium bis[2-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]benzoato(2-)]chromate(1-) is also used in environmental management practices to ensure proper handling and disposal. Strict regulations and guidelines are followed to minimize its impact on ecosystems and human health.
It is crucial to handle and dispose of sodium bis[2-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]benzoato(2-)]chromate(1-) with care, adhering to safety protocols to mitigate any risks associated with its use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 41741-86-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,7,4 and 1 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 41741-86:
(7*4)+(6*1)+(5*7)+(4*4)+(3*1)+(2*8)+(1*6)=110
110 % 10 = 0
So 41741-86-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H14N4O3.Cr/c1-11-15(16(22)21(20-11)12-7-3-2-4-8-12)19-18-14-10-6-5-9-13(14)17(23)24;/h2-10,15H,1H3,(H,23,24);/q;+3