4175-66-0 Usage
Uses
Used in Flavor and Fragrance Industry:
2,5-Dimethylthiazole is used as a flavoring agent for its characteristic nutty, roasted, and meaty aroma. It is widely utilized in the flavor and fragrance industry to enhance the taste and smell of various food products, such as meat, coffee, tea, cocoa, and roasted barley.
Used in the Food Industry:
In the food industry, 2,5-Dimethylthiazole is used as an additive to impart a rich, savory, and meaty flavor to processed foods. Its ability to mimic the taste of cooked meat makes it a popular ingredient in the production of vegetarian and vegan meat alternatives.
Used in the Chemical Industry:
2,5-Dimethylthiazole is also used in the chemical industry as a building block for the synthesis of various organic compounds and pharmaceuticals. Its unique structure and properties make it a valuable intermediate in the development of new molecules with potential applications in various fields.
Used in the Maillard Reaction:
2,5-Dimethylthiazole is formed in the D-glucose/L-cysteine Maillard system upon microwave irradiation or conventional heating. The Maillard reaction is a complex series of chemical reactions that occur when proteins and sugars are heated together, leading to the development of new flavors and aromas. The presence of 2,5-Dimethylthiazole in this reaction contributes to the overall taste and smell of cooked foods.
Synthesis Reference(s)
Journal of the American Chemical Society, 74, p. 5778, 1952 DOI: 10.1021/ja01142a515
Check Digit Verification of cas no
The CAS Registry Mumber 4175-66-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,1,7 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4175-66:
(6*4)+(5*1)+(4*7)+(3*5)+(2*6)+(1*6)=90
90 % 10 = 0
So 4175-66-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H7NS/c1-4-3-6-5(2)7-4/h3H,1-2H3
