41840-29-3 Usage
Uses
Used in Organic Synthesis:
P-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate is used as a reagent in organic synthesis for its ability to facilitate the formation of desired chemical products through its unique structural properties.
Used as a Protecting Group in Peptide Synthesis:
In the pharmaceutical industry, P-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate is used as a protecting group during the synthesis of peptide molecules. It helps prevent unwanted side reactions, ensuring the correct formation of peptide bonds and the overall integrity of the peptide structure.
Used in Oligonucleotide Synthesis:
Similarly, in the synthesis of oligonucleotides, P-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate is employed as a protecting group to shield functional groups from reacting until the desired time, which is crucial for the accurate assembly of oligonucleotide sequences.
Used in Pharmaceutical Preparation:
P-Methoxybenzyl S-(4,6-dimethylpyrimidin-2-yl) thiocarbonate is also used in the preparation of various pharmaceuticals, contributing to the development of new drugs by providing a stable and efficient synthetic pathway for the production of active pharmaceutical ingredients.
Check Digit Verification of cas no
The CAS Registry Mumber 41840-29-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,8,4 and 0 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 41840-29:
(7*4)+(6*1)+(5*8)+(4*4)+(3*0)+(2*2)+(1*9)=103
103 % 10 = 3
So 41840-29-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2O3S/c1-10-8-11(2)17-14(16-10)21-15(18)20-9-12-4-6-13(19-3)7-5-12/h4-8H,9H2,1-3H3
