418774-45-5 Usage
Uses
Used in Pharmaceutical Research:
BENZO[1,3]DIOXOL-5-YLMETHYL-(2-METHOXY-BENZYL)-AMINE is used as a building block for the development of new drugs in pharmaceutical research. Its unique structural features contribute to its potential for various biological activities, making it a valuable component in medicinal chemistry.
Used in Organic Synthesis:
In the field of organic synthesis, BENZO[1,3]DIOXOL-5-YLMETHYL-(2-METHOXY-BENZYL)-AMINE serves as a key component in the creation of complex organic molecules, facilitating the synthesis of a wide range of compounds.
Used in Material Development:
BENZO[1,3]DIOXOL-5-YLMETHYL-(2-METHOXY-BENZYL)-AMINE may also be utilized in the development of new materials, thanks to its structural properties that could contribute to the creation of innovative and improved materials with specific applications.
Used as a Reagent in Chemical Reactions:
BENZO[1,3]DIOXOL-5-YLMETHYL-(2-METHOXY-BENZYL)-AMINE is employed as a reagent in various chemical reactions, playing a crucial role in facilitating specific transformations and processes in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 418774-45-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,1,8,7,7 and 4 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 418774-45:
(8*4)+(7*1)+(6*8)+(5*7)+(4*7)+(3*4)+(2*4)+(1*5)=175
175 % 10 = 5
So 418774-45-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H17NO3/c1-18-14-5-3-2-4-13(14)10-17-9-12-6-7-15-16(8-12)20-11-19-15/h2-8,17H,9-11H2,1H3/p+1
