4192-35-2 Usage
Uses
Used in Pharmaceutical Industry:
1-(4-Hydroxycyclohexyl)-5-methylbarbituric acid is used as a sedative-hypnotic agent for its potential calming and sleep-inducing effects. Its chemical structure suggests that it may be effective in treating conditions such as anxiety, insomnia, and other sleep disorders.
Used in Research and Development:
In the field of pharmaceutical research and development, 1-(4-Hydroxycyclohexyl)-5-methylbarbituric acid serves as a promising compound for the creation of new therapeutic agents. Its unique structure may lead to the discovery of novel treatments for various health conditions, particularly those related to sleep and anxiety.
Check Digit Verification of cas no
The CAS Registry Mumber 4192-35-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,1,9 and 2 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 4192-35:
(6*4)+(5*1)+(4*9)+(3*2)+(2*3)+(1*5)=82
82 % 10 = 2
So 4192-35-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O4/c1-6-9(15)12-11(17)13(10(6)16)7-2-4-8(14)5-3-7/h6-8,14H,2-5H2,1H3,(H,12,15,17)
