4198-61-2 Usage
Structure
A benzimidazole derivative with a thiol group (-SH) attached to the 2-ethanethiol position and a methyl group attached to the 5-position.
Usage
Organic synthesis and pharmaceutical research as a building block for the synthesis of other compounds.
Potential applications
Development of drugs and agrochemicals, modification of reactivity of other chemical groups, materials science, and as a precursor for the synthesis of functionalized heterocycles.
Importance
Has important applications in various fields of chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 4198-61-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,1,9 and 8 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4198-61:
(6*4)+(5*1)+(4*9)+(3*8)+(2*6)+(1*1)=102
102 % 10 = 2
So 4198-61-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2S/c1-7-2-3-8-9(6-7)12-10(11-8)4-5-13/h2-3,6,13H,4-5H2,1H3,(H,11,12)
