42013-48-9 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
5,5-dimethyl-2-phenyl-morpholine serves as a crucial intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure allows it to be a key component in the development of new drugs and pesticides, contributing to advancements in healthcare and agriculture.
Used as a Corrosion Inhibitor:
In the field of material protection, 5,5-dimethyl-2-phenyl-morpholine is utilized as a corrosion inhibitor. Its ability to prevent or reduce the corrosion of metals in various environments makes it a valuable asset in industries such as oil and gas, where equipment protection is paramount.
Used in Rubber Chemical Production:
5,5-dimethyl-2-phenyl-morpholine is also employed as a component in the production of rubber chemicals. Its incorporation into rubber formulations enhances the properties of rubber products, improving their performance and durability in various applications.
Used in Metal Ion Extraction and Separation:
5,5-dimethyl-2-phenyl-morpholine has been studied for its potential use as a chelating agent in the extraction and separation of metal ions. Its ability to form stable complexes with metal ions makes it a promising candidate for applications in environmental remediation and resource recovery.
It is essential to follow proper handling and disposal procedures for 5,5-dimethyl-2-phenyl-morpholine to ensure the safety of the environment and human health, given its status as a chemical compound with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 42013-48-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,0,1 and 3 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 42013-48:
(7*4)+(6*2)+(5*0)+(4*1)+(3*3)+(2*4)+(1*8)=69
69 % 10 = 9
So 42013-48-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO/c1-12(2)9-14-11(8-13-12)10-6-4-3-5-7-10/h3-7,11,13H,8-9H2,1-2H3
