4202-74-8 Usage
Uses
Used in Pharmaceutical Industry:
Glycine anhydride is used as an intermediate for the production of various pharmaceuticals. It plays a crucial role in the synthesis of drugs, contributing to the development of new medications and therapies.
Used in Agrochemical Industry:
In the agrochemical industry, glycine anhydride is utilized as an intermediate in the synthesis of agrochemicals, which are essential for the protection and enhancement of crop yields.
Used in Chemical Synthesis:
Glycine anhydride is used as a building block in the synthesis of various chemical compounds, including peptides and chiral compounds. Its versatility in chemical reactions makes it a valuable component in the creation of complex organic molecules.
Used in Adhesive and Coating Production:
Glycine anhydride is used in the manufacture of high-performance adhesives and coatings, where its unique properties contribute to the development of durable and efficient products.
Used as a Corrosion Inhibitor:
In industrial applications, glycine anhydride can be used as a corrosion inhibitor, helping to protect materials from degradation and extending their lifespan.
Used as a Stabilizer in Plastics and Rubber Production:
Glycine anhydride also serves as a stabilizer in the production of plastics and rubber products, enhancing their stability and performance in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 4202-74-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,2,0 and 2 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 4202-74:
(6*4)+(5*2)+(4*0)+(3*2)+(2*7)+(1*4)=58
58 % 10 = 8
So 4202-74-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H8N2O3/c5-1-3(7)9-4(8)2-6/h1-2,5-6H2
