42059-75-6 Usage
Uses
Used in Pharmaceutical Research:
6,8-Dimethyl-3-formylchromone is utilized as a pharmaceutical research compound for its potential biological activities, including anti-inflammatory, anti-tumor, and antioxidant properties. Its diverse range of activities makes it a promising candidate for the development of new drugs to treat various medical conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 6,8-Dimethyl-3-formylchromone serves as a key intermediate or building block for the synthesis of more complex organic molecules. Its unique structure and functional groups make it a valuable component in the creation of novel compounds with specific properties and applications.
Used in Materials Science:
6,8-Dimethyl-3-formylchromone has been studied for its potential applications in materials science, particularly as a fluorescent probe for the detection of metal ions. Its ability to selectively interact with certain metal ions and exhibit fluorescence upon binding makes it a valuable tool in analytical chemistry and environmental monitoring.
Check Digit Verification of cas no
The CAS Registry Mumber 42059-75-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,0,5 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 42059-75:
(7*4)+(6*2)+(5*0)+(4*5)+(3*9)+(2*7)+(1*5)=106
106 % 10 = 6
So 42059-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H10O3/c1-7-3-8(2)12-10(4-7)11(14)9(5-13)6-15-12/h3-6H,1-2H3
