422280-53-3 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
1-(2-nitro-phenyl)-cyclopropanecarboxylic acid is used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure and functional groups make it a valuable building block for the development of new bioactive molecules and compounds with therapeutic or pesticidal properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-(2-nitro-phenyl)-cyclopropanecarboxylic acid is used as a key component in the design and synthesis of novel drug candidates. Its nitrophenyl group can undergo a variety of chemical reactions, allowing for the creation of diverse molecular structures with potential therapeutic effects.
Used in Chemical Research and Development:
1-(2-nitro-phenyl)-cyclopropanecarboxylic acid is an important compound for chemical research and development. Its structure and functional groups provide opportunities for exploring new synthetic pathways, reaction mechanisms, and the development of innovative chemical processes. 1-(2-nitro-phenyl)-cyclopropanecarboxylic acid contributes to the advancement of organic chemistry and the discovery of new chemical entities with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 422280-53-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,2,2,2,8 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 422280-53:
(8*4)+(7*2)+(6*2)+(5*2)+(4*8)+(3*0)+(2*5)+(1*3)=113
113 % 10 = 3
So 422280-53-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO4/c12-9(13)10(5-6-10)7-3-1-2-4-8(7)11(14)15/h1-4H,5-6H2,(H,12,13)
422280-53-3Relevant academic research and scientific papers
Substituted alkanoic acids
-
Page 39, (2010/02/05)
The invention is directed to physiologically active compounds of general formula (I): wherein:- represents (i) a saturated 3 to 6 membered carbocycle, optionally substituted by one or more alkyl groups, (ii) indanyl or (iii) a saturated 4 to 6 membered heterocyclic ring; R1 represents R3Z1-Het- or R4N(R5)—C(═O)—NH—Ar1—; L1 represents an —R6—R7— linkage; R2 represents hydrogen, halogen, lower alkyl or lower alkoxy; L2 represents an alkylene linkage; Y is carboxy or an acid bioisostere; and their corresponding N-oxides or prodrugs, and pharmaceutically acceptable salts and solvates of such compounds and their corresponding N-oxides or prodrugs. Such compounds have valuable pharmaceutical properties, in particular the ability to regulate the interaction of VCAM-1 and fibronectin with the integrin VLA-4 (α4β1).
