42282-85-9 Usage
Uses
Used in Pharmaceutical Industry:
3,3-Diethyl-2,4-azetidinedione is used as a synthetic intermediate for the production of malonamic acid, malonamate, and malonamide derivatives. These derivatives are crucial in the development of heterocyclic compounds with anti-inflammatory activity, which can be utilized in the pharmaceutical industry for the treatment of various inflammation-related conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 3,3-Diethyl-2,4-azetidinedione serves as a valuable building block for the creation of complex organic molecules. Its unique structure allows for further functionalization and modification, making it a versatile compound for the synthesis of a wide range of heterocyclic compounds with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Research and Development:
3,3-Diethyl-2,4-azetidinedione is also used as a research compound in academic and industrial laboratories. Its unique structure and reactivity make it an interesting subject for studying various chemical reactions and mechanisms, as well as for exploring its potential applications in the development of new drugs, materials, and other advanced technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 42282-85-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,2,8 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 42282-85:
(7*4)+(6*2)+(5*2)+(4*8)+(3*2)+(2*8)+(1*5)=109
109 % 10 = 9
So 42282-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO2/c1-3-7(4-2)5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10)