423120-09-6 Usage
Description
4-(2,4-Dimethoxyphenyl)-1,4,5,6-tetrahydro-2-methyl-6-oxo-3-pyridinecarboxylic acid is a complex chemical compound with a tetrahydro-2-methyl-6-oxo-3-pyridinecarboxylic acid core and a 4-(2,4-dimethoxyphenyl) substituent. It may have potential pharmaceutical applications due to its unique structure and could be studied for its potential therapeutic properties.
Uses
Used in Pharmaceutical Industry:
4-(2,4-Dimethoxyphenyl)-1,4,5,6-tetrahydro-2-methyl-6-oxo-3-pyridinecarboxylic acid is used as a potential pharmaceutical candidate for its unique structure and potential biological activity. Further investigation and analysis are needed to fully understand its potential uses and effects in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 423120-09-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,2,3,1,2 and 0 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 423120-09:
(8*4)+(7*2)+(6*3)+(5*1)+(4*2)+(3*0)+(2*0)+(1*9)=86
86 % 10 = 6
So 423120-09-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO3/c1-4-5(7(10)11)2-3-6(9)8-4/h2-3H,1H3,(H,8,9)(H,10,11)