423176-38-9 Usage
Pyrazole derivative
2-(3,5-Dimethyl-1H-pyrazol-4-yl)-ethylamine is a derivative of pyrazole, which is a five-membered heterocyclic compound with four carbon atoms and one nitrogen atom.
Amine and ethylamine functional groups
2-(3,5-Dimethyl-1H-pyrazol-4-yl)-ethylamine contains both amine (-NH2) and ethylamine (-NH-C2H5) functional groups, which contribute to its reactivity and potential applications in various fields.
Building block or intermediate in synthesis
2-(3,5-Dimethyl-1H-pyrazol-4-yl)-ethylamine is commonly used as a building block or intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds, indicating its importance in chemical synthesis.
Unique structure and reactivity
2-(3,5-Dimethyl-1H-pyrazol-4-yl)-ethylamine has a unique structure and reactivity, which makes it a valuable tool for chemists and researchers in various fields.
Potential applications in medicinal chemistry and drug development
2-(3,5-Dimethyl-1H-pyrazol-4-yl)-ethylamine may have potential applications in medicinal chemistry and drug development due to its structural similarity to bioactive compounds and its ability to modulate biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 423176-38-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,2,3,1,7 and 6 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 423176-38:
(8*4)+(7*2)+(6*3)+(5*1)+(4*7)+(3*6)+(2*3)+(1*8)=129
129 % 10 = 9
So 423176-38-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N3/c1-5-7(3-4-8)6(2)10-9-5/h3-4,8H2,1-2H3,(H,9,10)
423176-38-9Relevant articles and documents
Synthesis of β-aminoethyl-substituted pyrazoles
Kokoreva,Averina,Ivanova,Kozhushkov,Kuznetsova
, p. 834 - 839 (2007/10/03)
Methods have been developed for the synthesis of 3,5-dimethyl-4-(2-N-mono- and -disubstituted and also unsubstituted aminoethyl)pyrazoles from 1,1-diacetylcyclopropane.
