423768-45-0 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its unique structure allows for the development of compounds with potential applications in treating a range of diseases, including bacterial and fungal infections, due to its ability to inhibit essential biological processes in these organisms.
Used in Agrochemical Industry:
In the agrochemical sector, Ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate is used as a precursor in the production of pesticides and herbicides. Its chemical properties enable the creation of compounds that can effectively control pests and weeds, thereby protecting crops and increasing agricultural yields.
Used in Materials Science:
Ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate is utilized in materials science for the development of novel materials with specific properties. Its incorporation into polymers and other materials can enhance their stability, conductivity, or other desirable characteristics, making them suitable for use in various applications, such as sensors, electronic devices, or advanced coatings.
Used in Drug Discovery and Development:
The biological activity of Ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate makes it a valuable tool in drug discovery and development. Researchers can use Ethyl 2-(5-bromo-2-thienyl)-1,3-thiazole-4-carboxylate as a starting point for designing new drugs with potential therapeutic effects against various diseases, including cancer, neurological disorders, and inflammatory conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 423768-45-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,2,3,7,6 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 423768-45:
(8*4)+(7*2)+(6*3)+(5*7)+(4*6)+(3*8)+(2*4)+(1*5)=160
160 % 10 = 0
So 423768-45-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H8BrNO2S2/c1-2-14-10(13)6-5-15-9(12-6)7-3-4-8(11)16-7/h3-5H,2H2,1H3
