423768-55-2 Usage
General Description
(2-Morpholino-3-pyridinyl)methanol is a chemical compound with the molecular formula C9H12N2O2. It is a heterocyclic organic compound that contains a morpholine ring and a pyridine ring. (2-MORPHOLINO-3-PYRIDINYL)METHANOL is commonly used in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique structure and reactivity. It can also be used as a building block in the production of various biologically active compounds. Additionally, (2-Morpholino-3-pyridinyl)methanol has potential applications in medicinal chemistry and drug discovery due to its ability to modulate biological targets. Overall, this chemical exhibits versatility and potential for various applications in the fields of chemistry and pharmaceutical sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 423768-55-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,2,3,7,6 and 8 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 423768-55:
(8*4)+(7*2)+(6*3)+(5*7)+(4*6)+(3*8)+(2*5)+(1*5)=162
162 % 10 = 2
So 423768-55-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O2/c13-8-9-2-1-3-11-10(9)12-4-6-14-7-5-12/h1-3,13H,4-8H2