423768-62-1 Usage
General Description
(4-Phenyl-1,2,3-thiadiazol-5-yl)methanol is an organic compound with the molecular formula C9H8N2OS. It contains a thiadiazole ring, which is a five-membered aromatic ring containing nitrogen and sulfur atoms. The compound also has a phenyl group attached to the thiadiazole ring. This chemical has potential applications in medicinal chemistry and pharmaceuticals due to its interesting structural features and potential biological activities. Additionally, the presence of the hydroxyl group in the molecule makes it a potential candidate for further chemical modifications and derivatization. Overall, (4-Phenyl-1,2,3-thiadiazol-5-yl)methanol represents an interesting and promising chemical entity for various research and application purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 423768-62-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,2,3,7,6 and 8 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 423768-62:
(8*4)+(7*2)+(6*3)+(5*7)+(4*6)+(3*8)+(2*6)+(1*2)=161
161 % 10 = 1
So 423768-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2OS/c12-6-8-9(10-11-13-8)7-4-2-1-3-5-7/h1-5,12H,6H2