42578-08-5

Usage

Uses

Used in Pharmaceutical Industry:
1-Oxa-9-azaspiro[5.5]undecane is used as a building block for the synthesis of various bioactive compounds due to its potential biological activities and unique structure. It contributes to the development of new drugs by serving as a key component in the creation of pharmaceuticals with novel therapeutic properties.
Used in Agrochemical Industry:
1-Oxa-9-azaspiro[5.5]undecane is also utilized as a precursor in the synthesis of agrochemicals, where its unique structure can be leveraged to develop new compounds with applications in agriculture, such as pesticides or herbicides, enhancing crop protection and yield.
In the field of Organic Synthesis:
1-Oxa-9-azaspiro[5.5]undecane is used as an intermediate in organic synthesis processes for creating a variety of complex organic molecules. Its unique ring system allows for the formation of new chemical entities with potential applications in various industries.
In Medicinal Chemistry Research:
1-Oxa-9-azaspiro[5.5]undecane is used as a subject of study for researchers interested in the synthesis and characterization of new compounds with potential therapeutic uses. Its exploration aids in advancing the understanding of molecular structures that can influence biological activity and drug efficacy.

InChI:InChI=1/C9H17NO/c1-2-8-11-9(3-1)4-6-10-7-5-9/h10H,1-8H2