42839-91-8 Usage
Chemical compound
3-methoxy-2-methyl-fluoren-9-one
Derivative of
fluorenone
Functional groups
Methoxy group at the 3rd position
Methyl group at the 2nd position
Uses
Organic synthesis
Building block for various organic molecules
Fluorescent properties
Development of fluorescent probes and sensors
Unique properties
Unique chemical properties and reactivity
Valuable compound in organic chemistry
Check Digit Verification of cas no
The CAS Registry Mumber 42839-91-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,8,3 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 42839-91:
(7*4)+(6*2)+(5*8)+(4*3)+(3*9)+(2*9)+(1*1)=138
138 % 10 = 8
So 42839-91-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H12O2/c1-9-7-13-12(8-14(9)17-2)10-5-3-4-6-11(10)15(13)16/h3-8H,1-2H3